ChemNet > CAS > 499769-97-0 1-biphenylenylboronic acid
499769-97-0 1-biphenylenylboronic acid
Nama produk |
1-biphenylenylboronic acid |
Sinonim |
biphenylen-1-ylboronic acid |
MF |
C12H9BO2 |
Berat Molekul |
196.0097 |
InChI |
InChI=1/C12H9BO2/c14-13(15)11-7-3-6-10-8-4-1-2-5-9(8)12(10)11/h1-7,14-15H |
CAS NO |
499769-97-0 |
Struktur Molekul |
|
Kepadatan |
1.31g/cm3 |
Titik lebur |
250℃ |
Titik didih |
415.4°C at 760 mmHg |
Indeks bias |
1.751 |
Titik nyala |
205°C |
Cinta bahaya |
Xi:Irritant;
|
Kod Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|